C22H30ClN5O4S — CID 155187936
N-[2-(5-chloro-2-isocyanato-3-propan-2-ylphenyl)propyl]-1-methyl-5-(morpholin-4-ylmethyl)pyrazole-3-sulfonamide (PubChem CID 155187936) has the molecular formula C22H30ClN5O4S and a molecular weight of 496.03 g/mol. Its IUPAC name is N-[2-(5-chloro-2-isocyanato-3-propan-2-ylphenyl)propyl]-1-methyl-5-(morpholin-4-ylmethyl)pyrazole-3-sulfonamide.
| Compound Name | N-[2-(5-chloro-2-isocyanato-3-propan-2-ylphenyl)propyl]-1-methyl-5-(morpholin-4-ylmethyl)pyrazole-3-sulfonamide |
|---|---|
| PubChem CID | 155187936 |
| Molecular Formula | C22H30ClN5O4S |
| Molecular Weight | 496.03 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | N-[2-(5-chloro-2-isocyanato-3-propan-2-ylphenyl)propyl]-1-methyl-5-(morpholin-4-ylmethyl)pyrazole-3-sulfonamide |
| SMILES | CC(C)c1cc(Cl)cc(C(C)CNS(=O)(=O)c2cc(CN3CCOCC3)n(C)n2)c1N=C=O |
| InChI | InChI=1S/C22H30ClN5O4S/c1-15(2)19-9-17(23)10-20(22(19)24-14-29)16(3)12-25-33(30,31)21-11-18(27(4)26-21)13-28-5-7-32-8-6-28/h9-11,15-16,25H,5-8,12-13H2,1-4H3 |
| InChIKey | AKPXIIZAVLVULY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 105.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.03 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|