C12H22N2 — CID 155188783
5-methyl-2,3,4,4a,7,8,9,10,10a,10b-decahydro-1H-pyrido[1,2-b]indazole (PubChem CID 155188783) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is 5-methyl-2,3,4,4a,7,8,9,10,10a,10b-decahydro-1H-pyrido[1,2-b]indazole.
| Compound Name | 5-methyl-2,3,4,4a,7,8,9,10,10a,10b-decahydro-1H-pyrido[1,2-b]indazole |
|---|---|
| PubChem CID | 155188783 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 5-methyl-2,3,4,4a,7,8,9,10,10a,10b-decahydro-1H-pyrido[1,2-b]indazole |
| SMILES | CN1C2CCCCC2C2CCCCN21 |
| InChI | InChI=1S/C12H22N2/c1-13-11-7-3-2-6-10(11)12-8-4-5-9-14(12)13/h10-12H,2-9H2,1H3 |
| InChIKey | DRZZHKVZCUUZKE-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |