C12H15NO2S — CID 15518938
6-(benzenesulfonylmethyl)-2,3,4,5-tetrahydropyridine (PubChem CID 15518938) has the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. Its IUPAC name is 6-(benzenesulfonylmethyl)-2,3,4,5-tetrahydropyridine.
| Compound Name | 6-(benzenesulfonylmethyl)-2,3,4,5-tetrahydropyridine |
|---|---|
| PubChem CID | 15518938 |
| Molecular Formula | C12H15NO2S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 6-(benzenesulfonylmethyl)-2,3,4,5-tetrahydropyridine |
| SMILES | O=S(=O)(CC1=NCCCC1)c1ccccc1 |
| InChI | InChI=1S/C12H15NO2S/c14-16(15,12-7-2-1-3-8-12)10-11-6-4-5-9-13-11/h1-3,7-8H,4-6,9-10H2 |
| InChIKey | GWBALDAFZQCAEM-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |