C17H18N2O2 — CID 155191255
2-(3-ethynyl-8-methylquinolin-6-yl)oxy-2-methylbutanamide (PubChem CID 155191255) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is 2-(3-ethynyl-8-methylquinolin-6-yl)oxy-2-methylbutanamide.
| Compound Name | 2-(3-ethynyl-8-methylquinolin-6-yl)oxy-2-methylbutanamide |
|---|---|
| PubChem CID | 155191255 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 2-(3-ethynyl-8-methylquinolin-6-yl)oxy-2-methylbutanamide |
| SMILES | C#Cc1cnc2c(C)cc(OC(C)(CC)C(N)=O)cc2c1 |
| InChI | InChI=1S/C17H18N2O2/c1-5-12-8-13-9-14(7-11(3)15(13)19-10-12)21-17(4,6-2)16(18)20/h1,7-10H,6H2,2-4H3,(H2,18,20) |
| InChIKey | MGQYVONZYHUQKX-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|