C26H25N3O3 — CID 155195262
methyl 4-[1-benzyl-5-(3,5-dimethyl-1,2-oxazol-4-yl)pyrrolo[2,3-b]pyridin-3-yl]-2,2-dimethylbut-3-ynoate (PubChem CID 155195262) has the molecular formula C26H25N3O3 and a molecular weight of 427.50 g/mol. Its IUPAC name is methyl 4-[1-benzyl-5-(3,5-dimethyl-1,2-oxazol-4-yl)pyrrolo[2,3-b]pyridin-3-yl]-2,2-dimethylbut-3-ynoate.
| Compound Name | methyl 4-[1-benzyl-5-(3,5-dimethyl-1,2-oxazol-4-yl)pyrrolo[2,3-b]pyridin-3-yl]-2,2-dimethylbut-3-ynoate |
|---|---|
| PubChem CID | 155195262 |
| Molecular Formula | C26H25N3O3 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | methyl 4-[1-benzyl-5-(3,5-dimethyl-1,2-oxazol-4-yl)pyrrolo[2,3-b]pyridin-3-yl]-2,2-dimethylbut-3-ynoate |
| SMILES | COC(=O)C(C)(C)C#Cc1cn(Cc2ccccc2)c2ncc(-c3c(C)noc3C)cc12 |
| InChI | InChI=1S/C26H25N3O3/c1-17-23(18(2)32-28-17)21-13-22-20(11-12-26(3,4)25(30)31-5)16-29(24(22)27-14-21)15-19-9-7-6-8-10-19/h6-10,13-14,16H,15H2,1-5H3 |
| InChIKey | FMRUXUMMDMEKJO-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 70.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|