About [4-[(4-oxo-5H-pyrazolo[4,5-c]pyridin-1-yl)methyl]phenyl]phosphonic acid
[4-[(4-oxo-5H-pyrazolo[4,5-c]pyridin-1-yl)methyl]phenyl]phosphonic acid (PubChem CID 155195374) has the molecular formula C13H12N3O4P
and a molecular weight of 305.23 g/mol. Its IUPAC name is [4-[(4-oxo-5H-pyrazolo[4,5-c]pyridin-1-yl)methyl]phenyl]phosphonic acid.
Molecular Properties
| Compound Name | [4-[(4-oxo-5H-pyrazolo[4,5-c]pyridin-1-yl)methyl]phenyl]phosphonic acid |
| PubChem CID | 155195374 |
| Molecular Formula | C13H12N3O4P |
| Molecular Weight | 305.23 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | [4-[(4-oxo-5H-pyrazolo[4,5-c]pyridin-1-yl)methyl]phenyl]phosphonic acid |
| SMILES | O=c1[nH]ccc2c1cnn2Cc1ccc(P(=O)(O)O)cc1 |
| InChI | InChI=1S/C13H12N3O4P/c17-13-11-7-15-16(12(11)5-6-14-13)8-9-1-3-10(4-2-9)21(18,19)20/h1-7H,8H2,(H,14,17)(H2,18,19,20) |
| InChIKey | YQZOVMNCHZSTOW-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.23 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [4-[(4-oxo-5H-pyrazolo[4,5-c]pyridin-1-yl)methyl]phenyl]phosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(4-oxo-5H-pyrazolo[4,5-c]pyridin-1-yl)methyl]phenyl]phosphonic acid?
The IUPAC name of [4-[(4-oxo-5H-pyrazolo[4,5-c]pyridin-1-yl)methyl]phenyl]phosphonic acid (CID 155195374) is [4-[(4-oxo-5H-pyrazolo[4,5-c]pyridin-1-yl)methyl]phenyl]phosphonic acid.
What is the SMILES notation for [4-[(4-oxo-5H-pyrazolo[4,5-c]pyridin-1-yl)methyl]phenyl]phosphonic acid?
The canonical SMILES for [4-[(4-oxo-5H-pyrazolo[4,5-c]pyridin-1-yl)methyl]phenyl]phosphonic acid is O=c1[nH]ccc2c1cnn2Cc1ccc(P(=O)(O)O)cc1.
What is the InChIKey of [4-[(4-oxo-5H-pyrazolo[4,5-c]pyridin-1-yl)methyl]phenyl]phosphonic acid?
The InChIKey is YQZOVMNCHZSTOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N3O4P/c17-13-11-7-15-16(12(11)5-6-14-13)8-9-1-3-10(4-2-9)21(18,19)20/h1-7H,8H2,(H,14,17)(H2,18,19,20).
What are the key properties of [4-[(4-oxo-5H-pyrazolo[4,5-c]pyridin-1-yl)methyl]phenyl]phosphonic acid?
[4-[(4-oxo-5H-pyrazolo[4,5-c]pyridin-1-yl)methyl]phenyl]phosphonic acid has a molecular weight of 305.23 g/mol, XLogP of 0.58, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(4-oxo-5H-pyrazolo[4,5-c]pyridin-1-yl)methyl]phenyl]phosphonic acid is sourced from PubChem (CID 155195374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).