C19H20N3O3P — CID 155195380
1-[(4-diethoxyphosphorylphenyl)methyl]benzimidazole-5-carbonitrile (PubChem CID 155195380) has the molecular formula C19H20N3O3P and a molecular weight of 369.36 g/mol. Its IUPAC name is 1-[(4-diethoxyphosphorylphenyl)methyl]benzimidazole-5-carbonitrile.
| Compound Name | 1-[(4-diethoxyphosphorylphenyl)methyl]benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 155195380 |
| Molecular Formula | C19H20N3O3P |
| Molecular Weight | 369.36 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 1-[(4-diethoxyphosphorylphenyl)methyl]benzimidazole-5-carbonitrile |
| SMILES | CCOP(=O)(OCC)c1ccc(Cn2cnc3cc(C#N)ccc32)cc1 |
| InChI | InChI=1S/C19H20N3O3P/c1-3-24-26(23,25-4-2)17-8-5-15(6-9-17)13-22-14-21-18-11-16(12-20)7-10-19(18)22/h5-11,14H,3-4,13H2,1-2H3 |
| InChIKey | AWHSXRZLTVTYDH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 77.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.36 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|