C12H16FN — CID 155197845
4-ethynyl-N-(2-fluoroethyl)-N,1-dimethylcyclohexa-2,4-dien-1-amine (PubChem CID 155197845) has the molecular formula C12H16FN and a molecular weight of 193.26 g/mol. Its IUPAC name is 4-ethynyl-N-(2-fluoroethyl)-N,1-dimethylcyclohexa-2,4-dien-1-amine.
| Compound Name | 4-ethynyl-N-(2-fluoroethyl)-N,1-dimethylcyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 155197845 |
| Molecular Formula | C12H16FN |
| Molecular Weight | 193.26 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | 4-ethynyl-N-(2-fluoroethyl)-N,1-dimethylcyclohexa-2,4-dien-1-amine |
| SMILES | C#CC1=CCC(C)(N(C)CCF)C=C1 |
| InChI | InChI=1S/C12H16FN/c1-4-11-5-7-12(2,8-6-11)14(3)10-9-13/h1,5-7H,8-10H2,2-3H3 |
| InChIKey | YURKAGQKVCJEEG-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.26 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|