C12H17N — CID 139752000
N,N-diethyl-1-ethynylcyclohexa-2,4-dien-1-amine (PubChem CID 139752000) has the molecular formula C12H17N and a molecular weight of 175.27 g/mol. Its IUPAC name is N,N-diethyl-1-ethynylcyclohexa-2,4-dien-1-amine.
| Compound Name | N,N-diethyl-1-ethynylcyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 139752000 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | N,N-diethyl-1-ethynylcyclohexa-2,4-dien-1-amine |
| SMILES | C#CC1(N(CC)CC)C=CC=CC1 |
| InChI | InChI=1S/C12H17N/c1-4-12(13(5-2)6-3)10-8-7-9-11-12/h1,7-10H,5-6,11H2,2-3H3 |
| InChIKey | PIICEUFWIPLBFD-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|