C16H21N — CID 123173245
1-(5-ethenylcyclohepta-1,4,6-trien-1-yl)-N,N-diethylprop-2-yn-1-amine (PubChem CID 123173245) has the molecular formula C16H21N and a molecular weight of 227.35 g/mol. Its IUPAC name is 1-(5-ethenylcyclohepta-1,4,6-trien-1-yl)-N,N-diethylprop-2-yn-1-amine.
| Compound Name | 1-(5-ethenylcyclohepta-1,4,6-trien-1-yl)-N,N-diethylprop-2-yn-1-amine |
|---|---|
| PubChem CID | 123173245 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | 1-(5-ethenylcyclohepta-1,4,6-trien-1-yl)-N,N-diethylprop-2-yn-1-amine |
| SMILES | C#CC(C1=CCC=C(C=C)C=C1)N(CC)CC |
| InChI | InChI=1S/C16H21N/c1-5-14-10-9-11-15(13-12-14)16(6-2)17(7-3)8-4/h2,5,10-13,16H,1,7-9H2,3-4H3 |
| InChIKey | FXJMMSKSDCFNLF-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|