C22H26FN5O — CID 155198534
1-(5-cyano-3-fluoro-2-pyridinyl)-3-[4-(dimethylamino)-4-phenylcyclohexyl]-1-methylurea (PubChem CID 155198534) has the molecular formula C22H26FN5O and a molecular weight of 395.48 g/mol. Its IUPAC name is 1-(5-cyano-3-fluoro-2-pyridinyl)-3-[4-(dimethylamino)-4-phenylcyclohexyl]-1-methylurea.
| Compound Name | 1-(5-cyano-3-fluoro-2-pyridinyl)-3-[4-(dimethylamino)-4-phenylcyclohexyl]-1-methylurea |
|---|---|
| PubChem CID | 155198534 |
| Molecular Formula | C22H26FN5O |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 1-(5-cyano-3-fluoro-2-pyridinyl)-3-[4-(dimethylamino)-4-phenylcyclohexyl]-1-methylurea |
| SMILES | CN(C(=O)NC1CCC(c2ccccc2)(N(C)C)CC1)c1ncc(C#N)cc1F |
| InChI | InChI=1S/C22H26FN5O/c1-27(2)22(17-7-5-4-6-8-17)11-9-18(10-12-22)26-21(29)28(3)20-19(23)13-16(14-24)15-25-20/h4-8,13,15,18H,9-12H2,1-3H3,(H,26,29) |
| InChIKey | PCLAJKXGHNHSRF-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 72.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |