C23H34F3NO2 — CID 155199266
1-[2-(7-methylnonan-4-yl)-5-(trifluoromethyl)phenyl]piperidine-4-carboxylic acid (PubChem CID 155199266) has the molecular formula C23H34F3NO2 and a molecular weight of 413.52 g/mol. Its IUPAC name is 1-[2-(7-methylnonan-4-yl)-5-(trifluoromethyl)phenyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[2-(7-methylnonan-4-yl)-5-(trifluoromethyl)phenyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 155199266 |
| Molecular Formula | C23H34F3NO2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.25 |
| IUPAC Name | 1-[2-(7-methylnonan-4-yl)-5-(trifluoromethyl)phenyl]piperidine-4-carboxylic acid |
| SMILES | CCCC(CCC(C)CC)c1ccc(C(F)(F)F)cc1N1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C23H34F3NO2/c1-4-6-17(8-7-16(3)5-2)20-10-9-19(23(24,25)26)15-21(20)27-13-11-18(12-14-27)22(28)29/h9-10,15-18H,4-8,11-14H2,1-3H3,(H,28,29) |
| InChIKey | IXESICCDGPUSBQ-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |