C32H41F3N3O6S- — CID 155199274
1-[(3S,4R)-1-tert-butyl-4-(4-methoxyphenyl)pyrrolidine-3-carbonyl]-4-[2-[4-oxo-4-(sulfinatoamino)butoxy]-4-(trifluoromethyl)phenyl]piperidine (PubChem CID 155199274) has the molecular formula C32H41F3N3O6S- and a molecular weight of 652.76 g/mol. Its IUPAC name is 1-[(3S,4R)-1-tert-butyl-4-(4-methoxyphenyl)pyrrolidine-3-carbonyl]-4-[2-[4-oxo-4-(sulfinatoamino)butoxy]-4-(trifluoromethyl)phenyl]piperidine.
| Compound Name | 1-[(3S,4R)-1-tert-butyl-4-(4-methoxyphenyl)pyrrolidine-3-carbonyl]-4-[2-[4-oxo-4-(sulfinatoamino)butoxy]-4-(trifluoromethyl)phenyl]piperidine |
|---|---|
| PubChem CID | 155199274 |
| Molecular Formula | C32H41F3N3O6S- |
| Molecular Weight | 652.76 g/mol |
| Exact Mass | 652.27 |
| IUPAC Name | 1-[(3S,4R)-1-tert-butyl-4-(4-methoxyphenyl)pyrrolidine-3-carbonyl]-4-[2-[4-oxo-4-(sulfinatoamino)butoxy]-4-(trifluoromethyl)phenyl]piperidine |
| SMILES | COc1ccc([C@@H]2CN(C(C)(C)C)C[C@H]2C(=O)N2CCC(c3ccc(C(F)(F)F)cc3OCCCC(=O)NS(=O)[O-])CC2)cc1 |
| InChI | InChI=1S/C32H42F3N3O6S/c1-31(2,3)38-19-26(21-7-10-24(43-4)11-8-21)27(20-38)30(40)37-15-13-22(14-16-37)25-12-9-23(32(33,34)35)18-28(25)44-17-5-6-29(39)36-45(41)42/h7-12,18,22,26-27H,5-6,13-17,19-20H2,1-4H3,(H,36,39)(H,41,42)/p-1/t26-,27+/m0/s1 |
| InChIKey | LEZLKYUYMXBURW-RRPNLBNLSA-M |
| XLogP | 5.00 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.76 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|