C29H34F3NO5 — CID 118550974
tert-butyl 4-[2-(3-phenylmethoxycarbonylbut-3-enoxy)-4-(trifluoromethyl)phenyl]piperidine-1-carboxylate (PubChem CID 118550974) has the molecular formula C29H34F3NO5 and a molecular weight of 533.59 g/mol. Its IUPAC name is tert-butyl 4-[2-(3-phenylmethoxycarbonylbut-3-enoxy)-4-(trifluoromethyl)phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(3-phenylmethoxycarbonylbut-3-enoxy)-4-(trifluoromethyl)phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 118550974 |
| Molecular Formula | C29H34F3NO5 |
| Molecular Weight | 533.59 g/mol |
| Exact Mass | 533.24 |
| IUPAC Name | tert-butyl 4-[2-(3-phenylmethoxycarbonylbut-3-enoxy)-4-(trifluoromethyl)phenyl]piperidine-1-carboxylate |
| SMILES | C=C(CCOc1cc(C(F)(F)F)ccc1C1CCN(C(=O)OC(C)(C)C)CC1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C29H34F3NO5/c1-20(26(34)37-19-21-8-6-5-7-9-21)14-17-36-25-18-23(29(30,31)32)10-11-24(25)22-12-15-33(16-13-22)27(35)38-28(2,3)4/h5-11,18,22H,1,12-17,19H2,2-4H3 |
| InChIKey | XZZMNAADGYHXCU-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.59 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|