C21H28N2O2 — CID 15519991
2-(1-hydroxypropan-2-yl)-8,8-dimethyl-3-(methylamino)-4-methylimino-6,7-dihydro-5H-phenanthren-1-one (PubChem CID 15519991) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is 2-(1-hydroxypropan-2-yl)-8,8-dimethyl-3-(methylamino)-4-methylimino-6,7-dihydro-5H-phenanthren-1-one.
| Compound Name | 2-(1-hydroxypropan-2-yl)-8,8-dimethyl-3-(methylamino)-4-methylimino-6,7-dihydro-5H-phenanthren-1-one |
|---|---|
| PubChem CID | 15519991 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | 2-(1-hydroxypropan-2-yl)-8,8-dimethyl-3-(methylamino)-4-methylimino-6,7-dihydro-5H-phenanthren-1-one |
| SMILES | C/N=C1\C(NC)=C(C(C)CO)C(=O)c2ccc3c(c21)CCCC3(C)C |
| InChI | InChI=1S/C21H28N2O2/c1-12(11-24)16-18(22-4)19(23-5)17-13-7-6-10-21(2,3)15(13)9-8-14(17)20(16)25/h8-9,12,22,24H,6-7,10-11H2,1-5H3/b23-19- |
| InChIKey | DQAFKIBKXVBZDQ-NMWGTECJSA-N |
| XLogP | 3.02 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|