C23H32N2O2 — CID 15519992
3-(ethylamino)-4-ethylimino-2-(1-hydroxypropan-2-yl)-8,8-dimethyl-6,7-dihydro-5H-phenanthren-1-one (PubChem CID 15519992) has the molecular formula C23H32N2O2 and a molecular weight of 368.52 g/mol. Its IUPAC name is 3-(ethylamino)-4-ethylimino-2-(1-hydroxypropan-2-yl)-8,8-dimethyl-6,7-dihydro-5H-phenanthren-1-one.
| Compound Name | 3-(ethylamino)-4-ethylimino-2-(1-hydroxypropan-2-yl)-8,8-dimethyl-6,7-dihydro-5H-phenanthren-1-one |
|---|---|
| PubChem CID | 15519992 |
| Molecular Formula | C23H32N2O2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | 3-(ethylamino)-4-ethylimino-2-(1-hydroxypropan-2-yl)-8,8-dimethyl-6,7-dihydro-5H-phenanthren-1-one |
| SMILES | CC/N=C1\C(NCC)=C(C(C)CO)C(=O)c2ccc3c(c21)CCCC3(C)C |
| InChI | InChI=1S/C23H32N2O2/c1-6-24-20-18(14(3)13-26)22(27)16-10-11-17-15(9-8-12-23(17,4)5)19(16)21(20)25-7-2/h10-11,14,24,26H,6-9,12-13H2,1-5H3/b25-21- |
| InChIKey | RCWIYPKDQDSPER-DAFNUICNSA-N |
| XLogP | 3.80 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|