C15H27N7O2 — CID 155201791
5-N-[4-(diaminomethylideneamino)butyl]-2-N-pentyl-1H-imidazole-2,5-dicarboxamide (PubChem CID 155201791) has the molecular formula C15H27N7O2 and a molecular weight of 337.43 g/mol. Its IUPAC name is 5-N-[4-(diaminomethylideneamino)butyl]-2-N-pentyl-1H-imidazole-2,5-dicarboxamide.
| Compound Name | 5-N-[4-(diaminomethylideneamino)butyl]-2-N-pentyl-1H-imidazole-2,5-dicarboxamide |
|---|---|
| PubChem CID | 155201791 |
| Molecular Formula | C15H27N7O2 |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | 5-N-[4-(diaminomethylideneamino)butyl]-2-N-pentyl-1H-imidazole-2,5-dicarboxamide |
| SMILES | CCCCCNC(=O)c1ncc(C(=O)NCCCCN=C(N)N)[nH]1 |
| InChI | InChI=1S/C15H27N7O2/c1-2-3-4-7-19-14(24)12-21-10-11(22-12)13(23)18-8-5-6-9-20-15(16)17/h10H,2-9H2,1H3,(H,18,23)(H,19,24)(H,21,22)(H4,16,17,20) |
| InChIKey | CBNQJLCWORBTSN-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 151.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|