C24H22O5 — CID 155202497
1-methoxyethyl 6-[(E)-3-(4-methylphenyl)prop-2-enoyl]oxynaphthalene-2-carboxylate (PubChem CID 155202497) has the molecular formula C24H22O5 and a molecular weight of 390.44 g/mol. Its IUPAC name is 1-methoxyethyl 6-[(E)-3-(4-methylphenyl)prop-2-enoyl]oxynaphthalene-2-carboxylate.
| Compound Name | 1-methoxyethyl 6-[(E)-3-(4-methylphenyl)prop-2-enoyl]oxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 155202497 |
| Molecular Formula | C24H22O5 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 1-methoxyethyl 6-[(E)-3-(4-methylphenyl)prop-2-enoyl]oxynaphthalene-2-carboxylate |
| SMILES | COC(C)OC(=O)c1ccc2cc(OC(=O)/C=C/c3ccc(C)cc3)ccc2c1 |
| InChI | InChI=1S/C24H22O5/c1-16-4-6-18(7-5-16)8-13-23(25)29-22-12-11-19-14-21(10-9-20(19)15-22)24(26)28-17(2)27-3/h4-15,17H,1-3H3/b13-8+ |
| InChIKey | BGZGEVWCMCXMNQ-MDWZMJQESA-N |
| XLogP | 4.92 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|