C11H14ClNO3 — CID 155205393
1-(4-chloro-2-pyridinyl)-4,4-dimethoxybutan-1-one (PubChem CID 155205393) has the molecular formula C11H14ClNO3 and a molecular weight of 243.69 g/mol. Its IUPAC name is 1-(4-chloro-2-pyridinyl)-4,4-dimethoxybutan-1-one.
| Compound Name | 1-(4-chloro-2-pyridinyl)-4,4-dimethoxybutan-1-one |
|---|---|
| PubChem CID | 155205393 |
| Molecular Formula | C11H14ClNO3 |
| Molecular Weight | 243.69 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 1-(4-chloro-2-pyridinyl)-4,4-dimethoxybutan-1-one |
| SMILES | COC(CCC(=O)c1cc(Cl)ccn1)OC |
| InChI | InChI=1S/C11H14ClNO3/c1-15-11(16-2)4-3-10(14)9-7-8(12)5-6-13-9/h5-7,11H,3-4H2,1-2H3 |
| InChIKey | ISVMLCLYYZQZQQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.69 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|