C25H25N5O2 — CID 155206367
1-[4-[7-(dimethylamino)quinazolin-4-yl]oxyphenyl]-3-(2-phenylethyl)urea (PubChem CID 155206367) has the molecular formula C25H25N5O2 and a molecular weight of 427.51 g/mol. Its IUPAC name is 1-[4-[7-(dimethylamino)quinazolin-4-yl]oxyphenyl]-3-(2-phenylethyl)urea.
| Compound Name | 1-[4-[7-(dimethylamino)quinazolin-4-yl]oxyphenyl]-3-(2-phenylethyl)urea |
|---|---|
| PubChem CID | 155206367 |
| Molecular Formula | C25H25N5O2 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 1-[4-[7-(dimethylamino)quinazolin-4-yl]oxyphenyl]-3-(2-phenylethyl)urea |
| SMILES | CN(C)c1ccc2c(Oc3ccc(NC(=O)NCCc4ccccc4)cc3)ncnc2c1 |
| InChI | InChI=1S/C25H25N5O2/c1-30(2)20-10-13-22-23(16-20)27-17-28-24(22)32-21-11-8-19(9-12-21)29-25(31)26-15-14-18-6-4-3-5-7-18/h3-13,16-17H,14-15H2,1-2H3,(H2,26,29,31) |
| InChIKey | MKEYKLJJTYBXPA-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |