C27H25F3N4O3 — CID 5329488
2,2,2-trifluoro-N-[4-[4-(4-phenylmethoxyanilino)quinazolin-6-yl]oxybutyl]acetamide (PubChem CID 5329488) has the molecular formula C27H25F3N4O3 and a molecular weight of 510.52 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[4-[4-(4-phenylmethoxyanilino)quinazolin-6-yl]oxybutyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[4-[4-(4-phenylmethoxyanilino)quinazolin-6-yl]oxybutyl]acetamide |
|---|---|
| PubChem CID | 5329488 |
| Molecular Formula | C27H25F3N4O3 |
| Molecular Weight | 510.52 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | 2,2,2-trifluoro-N-[4-[4-(4-phenylmethoxyanilino)quinazolin-6-yl]oxybutyl]acetamide |
| SMILES | O=C(NCCCCOc1ccc2ncnc(Nc3ccc(OCc4ccccc4)cc3)c2c1)C(F)(F)F |
| InChI | InChI=1S/C27H25F3N4O3/c28-27(29,30)26(35)31-14-4-5-15-36-22-12-13-24-23(16-22)25(33-18-32-24)34-20-8-10-21(11-9-20)37-17-19-6-2-1-3-7-19/h1-3,6-13,16,18H,4-5,14-15,17H2,(H,31,35)(H,32,33,34) |
| InChIKey | BVASVOATLGXWDS-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.52 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|