C16H17ClN4O — CID 2952997
2-N-(4-ethoxyphenyl)quinazoline-2,4-diamine;hydrochloride (PubChem CID 2952997) has the molecular formula C16H17ClN4O and a molecular weight of 316.79 g/mol. Its IUPAC name is 2-N-(4-ethoxyphenyl)quinazoline-2,4-diamine;hydrochloride.
| Compound Name | 2-N-(4-ethoxyphenyl)quinazoline-2,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 2952997 |
| Molecular Formula | C16H17ClN4O |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 2-N-(4-ethoxyphenyl)quinazoline-2,4-diamine;hydrochloride |
| SMILES | CCOc1ccc(Nc2nc(N)c3ccccc3n2)cc1.Cl |
| InChI | InChI=1S/C16H16N4O.ClH/c1-2-21-12-9-7-11(8-10-12)18-16-19-14-6-4-3-5-13(14)15(17)20-16;/h3-10H,2H2,1H3,(H3,17,18,19,20);1H |
| InChIKey | DEGSOOYBAVYDEO-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |