About 1-methyl-3-octyl-4,5-dihydroimidazol-1-ium
1-methyl-3-octyl-4,5-dihydroimidazol-1-ium (PubChem CID 15520754) has the molecular formula C12H25N2+
and a molecular weight of 197.35 g/mol. Its IUPAC name is 1-methyl-3-octyl-4,5-dihydroimidazol-1-ium.
Molecular Properties
| Compound Name | 1-methyl-3-octyl-4,5-dihydroimidazol-1-ium |
| PubChem CID | 15520754 |
| Molecular Formula | C12H25N2+ |
| Molecular Weight | 197.35 g/mol |
| Exact Mass | 197.20 |
| IUPAC Name | 1-methyl-3-octyl-4,5-dihydroimidazol-1-ium |
| SMILES | CCCCCCCCN1C=[N+](C)CC1 |
| InChI | InChI=1S/C12H25N2/c1-3-4-5-6-7-8-9-14-11-10-13(2)12-14/h12H,3-11H2,1-2H3/q+1 |
| InChIKey | YNVSQLCQKRKXDQ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.35 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-3-octyl-4,5-dihydroimidazol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-octyl-4,5-dihydroimidazol-1-ium?
The IUPAC name of 1-methyl-3-octyl-4,5-dihydroimidazol-1-ium (CID 15520754) is 1-methyl-3-octyl-4,5-dihydroimidazol-1-ium.
What is the SMILES notation for 1-methyl-3-octyl-4,5-dihydroimidazol-1-ium?
The canonical SMILES for 1-methyl-3-octyl-4,5-dihydroimidazol-1-ium is CCCCCCCCN1C=[N+](C)CC1.
What is the InChIKey of 1-methyl-3-octyl-4,5-dihydroimidazol-1-ium?
The InChIKey is YNVSQLCQKRKXDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25N2/c1-3-4-5-6-7-8-9-14-11-10-13(2)12-14/h12H,3-11H2,1-2H3/q+1.
What are the key properties of 1-methyl-3-octyl-4,5-dihydroimidazol-1-ium?
1-methyl-3-octyl-4,5-dihydroimidazol-1-ium has a molecular weight of 197.35 g/mol, XLogP of 2.33, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-octyl-4,5-dihydroimidazol-1-ium is sourced from PubChem (CID 15520754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).