C19H18BrNO2 — CID 155212326
6-bromo-2-[1-(3-methoxyphenyl)but-3-enyl]-3H-isoindol-1-one (PubChem CID 155212326) has the molecular formula C19H18BrNO2 and a molecular weight of 372.26 g/mol. Its IUPAC name is 6-bromo-2-[1-(3-methoxyphenyl)but-3-enyl]-3H-isoindol-1-one.
| Compound Name | 6-bromo-2-[1-(3-methoxyphenyl)but-3-enyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 155212326 |
| Molecular Formula | C19H18BrNO2 |
| Molecular Weight | 372.26 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | 6-bromo-2-[1-(3-methoxyphenyl)but-3-enyl]-3H-isoindol-1-one |
| SMILES | C=CCC(c1cccc(OC)c1)N1Cc2ccc(Br)cc2C1=O |
| InChI | InChI=1S/C19H18BrNO2/c1-3-5-18(13-6-4-7-16(10-13)23-2)21-12-14-8-9-15(20)11-17(14)19(21)22/h3-4,6-11,18H,1,5,12H2,2H3 |
| InChIKey | BOTDCVKGTGCRII-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.26 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|