C20H32N2O2 — CID 155218899
tert-butyl 7-(4-ethynylcyclohexyl)-2,7-diazaspiro[3.5]nonane-2-carboxylate (PubChem CID 155218899) has the molecular formula C20H32N2O2 and a molecular weight of 332.49 g/mol. Its IUPAC name is tert-butyl 7-(4-ethynylcyclohexyl)-2,7-diazaspiro[3.5]nonane-2-carboxylate.
| Compound Name | tert-butyl 7-(4-ethynylcyclohexyl)-2,7-diazaspiro[3.5]nonane-2-carboxylate |
|---|---|
| PubChem CID | 155218899 |
| Molecular Formula | C20H32N2O2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.25 |
| IUPAC Name | tert-butyl 7-(4-ethynylcyclohexyl)-2,7-diazaspiro[3.5]nonane-2-carboxylate |
| SMILES | C#CC1CCC(N2CCC3(CC2)CN(C(=O)OC(C)(C)C)C3)CC1 |
| InChI | InChI=1S/C20H32N2O2/c1-5-16-6-8-17(9-7-16)21-12-10-20(11-13-21)14-22(15-20)18(23)24-19(2,3)4/h1,16-17H,6-15H2,2-4H3 |
| InChIKey | RLLHHVUQTQALKQ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|