C18H28N2O2 — CID 167417865
tert-butyl 6-(4-ethynylcyclohexyl)-2,6-diazaspiro[3.3]heptane-2-carboxylate (PubChem CID 167417865) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is tert-butyl 6-(4-ethynylcyclohexyl)-2,6-diazaspiro[3.3]heptane-2-carboxylate.
| Compound Name | tert-butyl 6-(4-ethynylcyclohexyl)-2,6-diazaspiro[3.3]heptane-2-carboxylate |
|---|---|
| PubChem CID | 167417865 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | tert-butyl 6-(4-ethynylcyclohexyl)-2,6-diazaspiro[3.3]heptane-2-carboxylate |
| SMILES | C#CC1CCC(N2CC3(CN(C(=O)OC(C)(C)C)C3)C2)CC1 |
| InChI | InChI=1S/C18H28N2O2/c1-5-14-6-8-15(9-7-14)19-10-18(11-19)12-20(13-18)16(21)22-17(2,3)4/h1,14-15H,6-13H2,2-4H3 |
| InChIKey | QTVKXOGEYIMIRJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|