C12H24N2S — CID 155220445
(9-methyl-6-propan-2-yl-3,6-diazabicyclo[3.2.2]nonan-3-yl)methanethiol (PubChem CID 155220445) has the molecular formula C12H24N2S and a molecular weight of 228.40 g/mol. Its IUPAC name is (9-methyl-6-propan-2-yl-3,6-diazabicyclo[3.2.2]nonan-3-yl)methanethiol.
| Compound Name | (9-methyl-6-propan-2-yl-3,6-diazabicyclo[3.2.2]nonan-3-yl)methanethiol |
|---|---|
| PubChem CID | 155220445 |
| Molecular Formula | C12H24N2S |
| Molecular Weight | 228.40 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | (9-methyl-6-propan-2-yl-3,6-diazabicyclo[3.2.2]nonan-3-yl)methanethiol |
| SMILES | CC1CC2CN(CS)CC1N(C(C)C)C2 |
| InChI | InChI=1S/C12H24N2S/c1-9(2)14-6-11-4-10(3)12(14)7-13(5-11)8-15/h9-12,15H,4-8H2,1-3H3 |
| InChIKey | CEWYMALKQQRNLZ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 6.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.40 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|