C10H17N — CID 171591162
6-propan-2-yl-6-azatricyclo[3.2.1.02,4]octane (PubChem CID 171591162) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is 6-propan-2-yl-6-azatricyclo[3.2.1.02,4]octane.
| Compound Name | 6-propan-2-yl-6-azatricyclo[3.2.1.02,4]octane |
|---|---|
| PubChem CID | 171591162 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 6-propan-2-yl-6-azatricyclo[3.2.1.02,4]octane |
| SMILES | CC(C)N1CC2CC1C1CC21 |
| InChI | InChI=1S/C10H17N/c1-6(2)11-5-7-3-10(11)9-4-8(7)9/h6-10H,3-5H2,1-2H3 |
| InChIKey | SNOJKSXBYIOTPV-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |