C24H46N4 — CID 170230574
7-propan-2-yl-3-[5-(7-propan-2-yl-3,7-diazabicyclo[4.2.0]octan-3-yl)hexan-2-yl]-3,7-diazabicyclo[4.2.0]octane (PubChem CID 170230574) has the molecular formula C24H46N4 and a molecular weight of 390.66 g/mol. Its IUPAC name is 7-propan-2-yl-3-[5-(7-propan-2-yl-3,7-diazabicyclo[4.2.0]octan-3-yl)hexan-2-yl]-3,7-diazabicyclo[4.2.0]octane.
| Compound Name | 7-propan-2-yl-3-[5-(7-propan-2-yl-3,7-diazabicyclo[4.2.0]octan-3-yl)hexan-2-yl]-3,7-diazabicyclo[4.2.0]octane |
|---|---|
| PubChem CID | 170230574 |
| Molecular Formula | C24H46N4 |
| Molecular Weight | 390.66 g/mol |
| Exact Mass | 390.37 |
| IUPAC Name | 7-propan-2-yl-3-[5-(7-propan-2-yl-3,7-diazabicyclo[4.2.0]octan-3-yl)hexan-2-yl]-3,7-diazabicyclo[4.2.0]octane |
| SMILES | CC(CCC(C)N1CCC2C(C1)CN2C(C)C)N1CCC2C(C1)CN2C(C)C |
| InChI | InChI=1S/C24H46N4/c1-17(2)27-15-21-13-25(11-9-23(21)27)19(5)7-8-20(6)26-12-10-24-22(14-26)16-28(24)18(3)4/h17-24H,7-16H2,1-6H3 |
| InChIKey | AEAQMOXXIQQEPV-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.66 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |