C18H26ClNO4 — CID 155220782
tert-butyl 4-[(3-chloro-5-methoxyphenyl)-hydroxymethyl]piperidine-1-carboxylate (PubChem CID 155220782) has the molecular formula C18H26ClNO4 and a molecular weight of 355.86 g/mol. Its IUPAC name is tert-butyl 4-[(3-chloro-5-methoxyphenyl)-hydroxymethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(3-chloro-5-methoxyphenyl)-hydroxymethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 155220782 |
| Molecular Formula | C18H26ClNO4 |
| Molecular Weight | 355.86 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | tert-butyl 4-[(3-chloro-5-methoxyphenyl)-hydroxymethyl]piperidine-1-carboxylate |
| SMILES | COc1cc(Cl)cc(C(O)C2CCN(C(=O)OC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C18H26ClNO4/c1-18(2,3)24-17(22)20-7-5-12(6-8-20)16(21)13-9-14(19)11-15(10-13)23-4/h9-12,16,21H,5-8H2,1-4H3 |
| InChIKey | KLNPEQXYJNTPIO-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.86 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |