C19H32N2O3 — CID 163385940
tert-butyl 4-[hydroxy-(6-methyl-3-pyridinyl)methyl]piperidine-1-carboxylate;ethane (PubChem CID 163385940) has the molecular formula C19H32N2O3 and a molecular weight of 336.48 g/mol. Its IUPAC name is tert-butyl 4-[hydroxy-(6-methyl-3-pyridinyl)methyl]piperidine-1-carboxylate;ethane.
| Compound Name | tert-butyl 4-[hydroxy-(6-methyl-3-pyridinyl)methyl]piperidine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 163385940 |
| Molecular Formula | C19H32N2O3 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.24 |
| IUPAC Name | tert-butyl 4-[hydroxy-(6-methyl-3-pyridinyl)methyl]piperidine-1-carboxylate;ethane |
| SMILES | CC.Cc1ccc(C(O)C2CCN(C(=O)OC(C)(C)C)CC2)cn1 |
| InChI | InChI=1S/C17H26N2O3.C2H6/c1-12-5-6-14(11-18-12)15(20)13-7-9-19(10-8-13)16(21)22-17(2,3)4;1-2/h5-6,11,13,15,20H,7-10H2,1-4H3;1-2H3 |
| InChIKey | YSKMGOLKBMWBQP-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |