C21H18N6O2 — CID 155223695
N',N'-dimethyl-N-[4-[5-(1H-pyrazolo[3,4-b]pyridin-4-yl)-3-pyridinyl]phenyl]oxamide (PubChem CID 155223695) has the molecular formula C21H18N6O2 and a molecular weight of 386.42 g/mol. Its IUPAC name is N',N'-dimethyl-N-[4-[5-(1H-pyrazolo[3,4-b]pyridin-4-yl)-3-pyridinyl]phenyl]oxamide.
| Compound Name | N',N'-dimethyl-N-[4-[5-(1H-pyrazolo[3,4-b]pyridin-4-yl)-3-pyridinyl]phenyl]oxamide |
|---|---|
| PubChem CID | 155223695 |
| Molecular Formula | C21H18N6O2 |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | N',N'-dimethyl-N-[4-[5-(1H-pyrazolo[3,4-b]pyridin-4-yl)-3-pyridinyl]phenyl]oxamide |
| SMILES | CN(C)C(=O)C(=O)Nc1ccc(-c2cncc(-c3ccnc4[nH]ncc34)c2)cc1 |
| InChI | InChI=1S/C21H18N6O2/c1-27(2)21(29)20(28)25-16-5-3-13(4-6-16)14-9-15(11-22-10-14)17-7-8-23-19-18(17)12-24-26-19/h3-12H,1-2H3,(H,25,28)(H,23,24,26) |
| InChIKey | KTFRUTCWYACULE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|