C20H42O — CID 155226811
(3S,10S,13S)-13-ethyl-3,10-dimethylhexadecan-3-ol (PubChem CID 155226811) has the molecular formula C20H42O and a molecular weight of 298.56 g/mol. Its IUPAC name is (3S,10S,13S)-13-ethyl-3,10-dimethylhexadecan-3-ol.
| Compound Name | (3S,10S,13S)-13-ethyl-3,10-dimethylhexadecan-3-ol |
|---|---|
| PubChem CID | 155226811 |
| Molecular Formula | C20H42O |
| Molecular Weight | 298.56 g/mol |
| Exact Mass | 298.32 |
| IUPAC Name | (3S,10S,13S)-13-ethyl-3,10-dimethylhexadecan-3-ol |
| SMILES | CCC[C@H](CC)CC[C@@H](C)CCCCCC[C@@](C)(O)CC |
| InChI | InChI=1S/C20H42O/c1-6-13-19(7-2)16-15-18(4)14-11-9-10-12-17-20(5,21)8-3/h18-19,21H,6-17H2,1-5H3/t18-,19-,20-/m0/s1 |
| InChIKey | VISBOOOGABAYBZ-UFYCRDLUSA-N |
| XLogP | 6.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.56 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|