C19H23FN6OS — CID 155227239
N-[amino(cyclobutyl)methylidene]-2-[4-(3-fluoro-4-methylbenzoyl)-2-iminopiperazin-1-yl]-2-iminoethanethioamide (PubChem CID 155227239) has the molecular formula C19H23FN6OS and a molecular weight of 402.50 g/mol. Its IUPAC name is N-[amino(cyclobutyl)methylidene]-2-[4-(3-fluoro-4-methylbenzoyl)-2-iminopiperazin-1-yl]-2-iminoethanethioamide.
| Compound Name | N-[amino(cyclobutyl)methylidene]-2-[4-(3-fluoro-4-methylbenzoyl)-2-iminopiperazin-1-yl]-2-iminoethanethioamide |
|---|---|
| PubChem CID | 155227239 |
| Molecular Formula | C19H23FN6OS |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | N-[amino(cyclobutyl)methylidene]-2-[4-(3-fluoro-4-methylbenzoyl)-2-iminopiperazin-1-yl]-2-iminoethanethioamide |
| SMILES | [H]/N=C1\CN(C(=O)c2ccc(C)c(F)c2)CCN1/C(=N/[H])C(=S)/N=C(\N)C1CCC1 |
| InChI | InChI=1S/C19H23FN6OS/c1-11-5-6-13(9-14(11)20)19(27)25-7-8-26(15(21)10-25)17(23)18(28)24-16(22)12-3-2-4-12/h5-6,9,12,21,23H,2-4,7-8,10H2,1H3,(H2,22,24,28)/b21-15+,23-17+ |
| InChIKey | MILCODWEHWDXKB-HUEIUYTNSA-N |
| XLogP | 2.33 |
| TPSA | 109.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|