C16H17FN6O2 — CID 155227255
(4-fluoro-3-methylphenyl)-[3-imino-4-(5-methyl-1,3,4-oxadiazole-2-carboximidoyl)piperazin-1-yl]methanone (PubChem CID 155227255) has the molecular formula C16H17FN6O2 and a molecular weight of 344.35 g/mol. Its IUPAC name is (4-fluoro-3-methylphenyl)-[3-imino-4-(5-methyl-1,3,4-oxadiazole-2-carboximidoyl)piperazin-1-yl]methanone.
| Compound Name | (4-fluoro-3-methylphenyl)-[3-imino-4-(5-methyl-1,3,4-oxadiazole-2-carboximidoyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 155227255 |
| Molecular Formula | C16H17FN6O2 |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | (4-fluoro-3-methylphenyl)-[3-imino-4-(5-methyl-1,3,4-oxadiazole-2-carboximidoyl)piperazin-1-yl]methanone |
| SMILES | [H]/N=C1\CN(C(=O)c2ccc(F)c(C)c2)CCN1/C(=N/[H])c1nnc(C)o1 |
| InChI | InChI=1S/C16H17FN6O2/c1-9-7-11(3-4-12(9)17)16(24)22-5-6-23(13(18)8-22)14(19)15-21-20-10(2)25-15/h3-4,7,18-19H,5-6,8H2,1-2H3/b18-13+,19-14+ |
| InChIKey | NXWNSZYSPAFZOX-JIBZRZDWSA-N |
| XLogP | 1.59 |
| TPSA | 110.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|