C16H17FN6OS — CID 155227687
(4-fluorophenyl)-[3-imino-5-methyl-4-(3-methyl-1,2,4-thiadiazole-5-carboximidoyl)piperazin-1-yl]methanone (PubChem CID 155227687) has the molecular formula C16H17FN6OS and a molecular weight of 360.42 g/mol. Its IUPAC name is (4-fluorophenyl)-[3-imino-5-methyl-4-(3-methyl-1,2,4-thiadiazole-5-carboximidoyl)piperazin-1-yl]methanone.
| Compound Name | (4-fluorophenyl)-[3-imino-5-methyl-4-(3-methyl-1,2,4-thiadiazole-5-carboximidoyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 155227687 |
| Molecular Formula | C16H17FN6OS |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | (4-fluorophenyl)-[3-imino-5-methyl-4-(3-methyl-1,2,4-thiadiazole-5-carboximidoyl)piperazin-1-yl]methanone |
| SMILES | [H]/N=C1\CN(C(=O)c2ccc(F)cc2)CC(C)N1/C(=N/[H])c1nc(C)ns1 |
| InChI | InChI=1S/C16H17FN6OS/c1-9-7-22(16(24)11-3-5-12(17)6-4-11)8-13(18)23(9)14(19)15-20-10(2)21-25-15/h3-6,9,18-19H,7-8H2,1-2H3/b18-13+,19-14+ |
| InChIKey | VWQCPYJXTXGUHN-JIBZRZDWSA-N |
| XLogP | 2.13 |
| TPSA | 97.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|