C19H17Cl2FN4O — CID 139397116
(2,3-dichlorophenyl)-[4-(4-fluorobenzenecarboximidoyl)-5-imino-2-methylpiperazin-1-yl]methanone (PubChem CID 139397116) has the molecular formula C19H17Cl2FN4O and a molecular weight of 407.28 g/mol. Its IUPAC name is (2,3-dichlorophenyl)-[4-(4-fluorobenzenecarboximidoyl)-5-imino-2-methylpiperazin-1-yl]methanone.
| Compound Name | (2,3-dichlorophenyl)-[4-(4-fluorobenzenecarboximidoyl)-5-imino-2-methylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 139397116 |
| Molecular Formula | C19H17Cl2FN4O |
| Molecular Weight | 407.28 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | (2,3-dichlorophenyl)-[4-(4-fluorobenzenecarboximidoyl)-5-imino-2-methylpiperazin-1-yl]methanone |
| SMILES | [H]/N=C1\CN(C(=O)c2cccc(Cl)c2Cl)C(C)CN1/C(=N/[H])c1ccc(F)cc1 |
| InChI | InChI=1S/C19H17Cl2FN4O/c1-11-9-26(18(24)12-5-7-13(22)8-6-12)16(23)10-25(11)19(27)14-3-2-4-15(20)17(14)21/h2-8,11,23-24H,9-10H2,1H3/b23-16+,24-18+ |
| InChIKey | AAVJGNXXGNVURG-LRZMZADRSA-N |
| XLogP | 4.28 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.28 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|