C18H16Cl2FN5O — CID 139397004
(2,3-dichlorophenyl)-[(2S)-4-(4-fluoropyridine-2-carboximidoyl)-5-imino-2-methylpiperazin-1-yl]methanone (PubChem CID 139397004) has the molecular formula C18H16Cl2FN5O and a molecular weight of 408.26 g/mol. Its IUPAC name is (2,3-dichlorophenyl)-[(2S)-4-(4-fluoropyridine-2-carboximidoyl)-5-imino-2-methylpiperazin-1-yl]methanone.
| Compound Name | (2,3-dichlorophenyl)-[(2S)-4-(4-fluoropyridine-2-carboximidoyl)-5-imino-2-methylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 139397004 |
| Molecular Formula | C18H16Cl2FN5O |
| Molecular Weight | 408.26 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | (2,3-dichlorophenyl)-[(2S)-4-(4-fluoropyridine-2-carboximidoyl)-5-imino-2-methylpiperazin-1-yl]methanone |
| SMILES | [H]/N=C1\CN(C(=O)c2cccc(Cl)c2Cl)[C@@H](C)CN1/C(=N/[H])c1cc(F)ccn1 |
| InChI | InChI=1S/C18H16Cl2FN5O/c1-10-8-26(17(23)14-7-11(21)5-6-24-14)15(22)9-25(10)18(27)12-3-2-4-13(19)16(12)20/h2-7,10,22-23H,8-9H2,1H3/b22-15+,23-17+/t10-/m0/s1 |
| InChIKey | PGDHZHNEXSLKKV-QBXSJKHJSA-N |
| XLogP | 3.68 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.26 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|