C20H17ClF4N4O — CID 139397161
[2-chloro-3-(trifluoromethyl)phenyl]-[4-ethanimidoyl-2-(4-fluorophenyl)-3-iminopiperazin-1-yl]methanone (PubChem CID 139397161) has the molecular formula C20H17ClF4N4O and a molecular weight of 440.83 g/mol. Its IUPAC name is [2-chloro-3-(trifluoromethyl)phenyl]-[4-ethanimidoyl-2-(4-fluorophenyl)-3-iminopiperazin-1-yl]methanone.
| Compound Name | [2-chloro-3-(trifluoromethyl)phenyl]-[4-ethanimidoyl-2-(4-fluorophenyl)-3-iminopiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 139397161 |
| Molecular Formula | C20H17ClF4N4O |
| Molecular Weight | 440.83 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | [2-chloro-3-(trifluoromethyl)phenyl]-[4-ethanimidoyl-2-(4-fluorophenyl)-3-iminopiperazin-1-yl]methanone |
| SMILES | [H]/N=C1/C(c2ccc(F)cc2)N(C(=O)c2cccc(C(F)(F)F)c2Cl)CCN1/C(C)=N/[H] |
| InChI | InChI=1S/C20H17ClF4N4O/c1-11(26)28-9-10-29(17(18(28)27)12-5-7-13(22)8-6-12)19(30)14-3-2-4-15(16(14)21)20(23,24)25/h2-8,17,26-27H,9-10H2,1H3/b26-11+,27-18- |
| InChIKey | AOENXTOHKQKLSV-SUPGXSJCSA-N |
| XLogP | 4.97 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.83 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|