C18H14ClF4N5O — CID 162545450
[2-chloro-3-(trifluoromethyl)phenyl]-[4-(3-fluoropyridine-2-carboximidoyl)-3-iminopiperazin-1-yl]methanone (PubChem CID 162545450) has the molecular formula C18H14ClF4N5O and a molecular weight of 427.79 g/mol. Its IUPAC name is [2-chloro-3-(trifluoromethyl)phenyl]-[4-(3-fluoropyridine-2-carboximidoyl)-3-iminopiperazin-1-yl]methanone.
| Compound Name | [2-chloro-3-(trifluoromethyl)phenyl]-[4-(3-fluoropyridine-2-carboximidoyl)-3-iminopiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 162545450 |
| Molecular Formula | C18H14ClF4N5O |
| Molecular Weight | 427.79 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | [2-chloro-3-(trifluoromethyl)phenyl]-[4-(3-fluoropyridine-2-carboximidoyl)-3-iminopiperazin-1-yl]methanone |
| SMILES | [H]/N=C1\CN(C(=O)c2cccc(C(F)(F)F)c2Cl)CCN1/C(=N/[H])c1ncccc1F |
| InChI | InChI=1S/C18H14ClF4N5O/c19-14-10(3-1-4-11(14)18(21,22)23)17(29)27-7-8-28(13(24)9-27)16(25)15-12(20)5-2-6-26-15/h1-6,24-25H,7-9H2/b24-13+,25-16+ |
| InChIKey | RJNVAGRDZIHUEA-SMQVFWRZSA-N |
| XLogP | 3.65 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.79 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|