C19H17ClF3N5O — CID 139397084
[2-chloro-3-(trifluoromethyl)phenyl]-(4-ethanimidoyl-3-imino-2-pyridin-2-ylpiperazin-1-yl)methanone (PubChem CID 139397084) has the molecular formula C19H17ClF3N5O and a molecular weight of 423.83 g/mol. Its IUPAC name is [2-chloro-3-(trifluoromethyl)phenyl]-(4-ethanimidoyl-3-imino-2-pyridin-2-ylpiperazin-1-yl)methanone.
| Compound Name | [2-chloro-3-(trifluoromethyl)phenyl]-(4-ethanimidoyl-3-imino-2-pyridin-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 139397084 |
| Molecular Formula | C19H17ClF3N5O |
| Molecular Weight | 423.83 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | [2-chloro-3-(trifluoromethyl)phenyl]-(4-ethanimidoyl-3-imino-2-pyridin-2-ylpiperazin-1-yl)methanone |
| SMILES | [H]/N=C1/C(c2ccccn2)N(C(=O)c2cccc(C(F)(F)F)c2Cl)CCN1/C(C)=N/[H] |
| InChI | InChI=1S/C19H17ClF3N5O/c1-11(24)27-9-10-28(16(17(27)25)14-7-2-3-8-26-14)18(29)12-5-4-6-13(15(12)20)19(21,22)23/h2-8,16,24-25H,9-10H2,1H3/b24-11+,25-17- |
| InChIKey | SHGDWNWDAMSSMA-FNFBYMGASA-N |
| XLogP | 4.23 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.83 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|