About (2R)-2-amino-3-ethenylimino-N'-ethylbutanimidamide
(2R)-2-amino-3-ethenylimino-N'-ethylbutanimidamide (PubChem CID 155227993) has the molecular formula C8H16N4
and a molecular weight of 168.24 g/mol. Its IUPAC name is (2R)-2-amino-3-ethenylimino-N'-ethylbutanimidamide.
Molecular Properties
| Compound Name | (2R)-2-amino-3-ethenylimino-N'-ethylbutanimidamide |
| PubChem CID | 155227993 |
| Molecular Formula | C8H16N4 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.14 |
| IUPAC Name | (2R)-2-amino-3-ethenylimino-N'-ethylbutanimidamide |
| SMILES | C=C/N=C(\C)[C@@H](N)/C(N)=N/CC |
| InChI | InChI=1S/C8H16N4/c1-4-11-6(3)7(9)8(10)12-5-2/h4,7H,1,5,9H2,2-3H3,(H2,10,12)/b11-6+/t7-/m1/s1 |
| InChIKey | PKCKENQNPVDVLP-PKTIUJEHSA-N |
| XLogP | 0.30 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-amino-3-ethenylimino-N'-ethylbutanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-amino-3-ethenylimino-N'-ethylbutanimidamide?
The IUPAC name of (2R)-2-amino-3-ethenylimino-N'-ethylbutanimidamide (CID 155227993) is (2R)-2-amino-3-ethenylimino-N'-ethylbutanimidamide.
What is the SMILES notation for (2R)-2-amino-3-ethenylimino-N'-ethylbutanimidamide?
The canonical SMILES for (2R)-2-amino-3-ethenylimino-N'-ethylbutanimidamide is C=C/N=C(\C)[C@@H](N)/C(N)=N/CC.
What is the InChIKey of (2R)-2-amino-3-ethenylimino-N'-ethylbutanimidamide?
The InChIKey is PKCKENQNPVDVLP-PKTIUJEHSA-N. The full InChI is InChI=1S/C8H16N4/c1-4-11-6(3)7(9)8(10)12-5-2/h4,7H,1,5,9H2,2-3H3,(H2,10,12)/b11-6+/t7-/m1/s1.
What are the key properties of (2R)-2-amino-3-ethenylimino-N'-ethylbutanimidamide?
(2R)-2-amino-3-ethenylimino-N'-ethylbutanimidamide has a molecular weight of 168.24 g/mol, XLogP of 0.30, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-3-ethenylimino-N'-ethylbutanimidamide is sourced from PubChem (CID 155227993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).