About (3Z)-N'-ethenyl-2-methyl-3-(propan-2-ylidenehydrazinylidene)butanimidamide
(3Z)-N'-ethenyl-2-methyl-3-(propan-2-ylidenehydrazinylidene)butanimidamide (PubChem CID 90934415) has the molecular formula C10H18N4
and a molecular weight of 194.28 g/mol. Its IUPAC name is (3Z)-N'-ethenyl-2-methyl-3-(propan-2-ylidenehydrazinylidene)butanimidamide.
Molecular Properties
| Compound Name | (3Z)-N'-ethenyl-2-methyl-3-(propan-2-ylidenehydrazinylidene)butanimidamide |
| PubChem CID | 90934415 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | (3Z)-N'-ethenyl-2-methyl-3-(propan-2-ylidenehydrazinylidene)butanimidamide |
| SMILES | C=C/N=C(\N)C(C)/C(C)=N\N=C(C)C |
| InChI | InChI=1S/C10H18N4/c1-6-12-10(11)8(4)9(5)14-13-7(2)3/h6,8H,1H2,2-5H3,(H2,11,12)/b14-9- |
| InChIKey | OYLFRBRSUHZDPK-ZROIWOOFSA-N |
| XLogP | 1.98 |
| TPSA | 63.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-N'-ethenyl-2-methyl-3-(propan-2-ylidenehydrazinylidene)butanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-N'-ethenyl-2-methyl-3-(propan-2-ylidenehydrazinylidene)butanimidamide?
The IUPAC name of (3Z)-N'-ethenyl-2-methyl-3-(propan-2-ylidenehydrazinylidene)butanimidamide (CID 90934415) is (3Z)-N'-ethenyl-2-methyl-3-(propan-2-ylidenehydrazinylidene)butanimidamide.
What is the SMILES notation for (3Z)-N'-ethenyl-2-methyl-3-(propan-2-ylidenehydrazinylidene)butanimidamide?
The canonical SMILES for (3Z)-N'-ethenyl-2-methyl-3-(propan-2-ylidenehydrazinylidene)butanimidamide is C=C/N=C(\N)C(C)/C(C)=N\N=C(C)C.
What is the InChIKey of (3Z)-N'-ethenyl-2-methyl-3-(propan-2-ylidenehydrazinylidene)butanimidamide?
The InChIKey is OYLFRBRSUHZDPK-ZROIWOOFSA-N. The full InChI is InChI=1S/C10H18N4/c1-6-12-10(11)8(4)9(5)14-13-7(2)3/h6,8H,1H2,2-5H3,(H2,11,12)/b14-9-.
What are the key properties of (3Z)-N'-ethenyl-2-methyl-3-(propan-2-ylidenehydrazinylidene)butanimidamide?
(3Z)-N'-ethenyl-2-methyl-3-(propan-2-ylidenehydrazinylidene)butanimidamide has a molecular weight of 194.28 g/mol, XLogP of 1.98, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-N'-ethenyl-2-methyl-3-(propan-2-ylidenehydrazinylidene)butanimidamide is sourced from PubChem (CID 90934415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).