C41H52N4O5 — CID 155229327
3-[3-oxo-6-[4-(2-phenylmethoxyethyl)piperidin-1-yl]-1H-isoindol-2-yl]piperidine-2,6-dione;4-(2-phenylmethoxyethyl)piperidine (PubChem CID 155229327) has the molecular formula C41H52N4O5 and a molecular weight of 680.89 g/mol. Its IUPAC name is 3-[3-oxo-6-[4-(2-phenylmethoxyethyl)piperidin-1-yl]-1H-isoindol-2-yl]piperidine-2,6-dione;4-(2-phenylmethoxyethyl)piperidine.
| Compound Name | 3-[3-oxo-6-[4-(2-phenylmethoxyethyl)piperidin-1-yl]-1H-isoindol-2-yl]piperidine-2,6-dione;4-(2-phenylmethoxyethyl)piperidine |
|---|---|
| PubChem CID | 155229327 |
| Molecular Formula | C41H52N4O5 |
| Molecular Weight | 680.89 g/mol |
| Exact Mass | 680.39 |
| IUPAC Name | 3-[3-oxo-6-[4-(2-phenylmethoxyethyl)piperidin-1-yl]-1H-isoindol-2-yl]piperidine-2,6-dione;4-(2-phenylmethoxyethyl)piperidine |
| SMILES | O=C1CCC(N2Cc3cc(N4CCC(CCOCc5ccccc5)CC4)ccc3C2=O)C(=O)N1.c1ccc(COCCC2CCNCC2)cc1 |
| InChI | InChI=1S/C27H31N3O4.C14H21NO/c31-25-9-8-24(26(32)28-25)30-17-21-16-22(6-7-23(21)27(30)33)29-13-10-19(11-14-29)12-15-34-18-20-4-2-1-3-5-20;1-2-4-14(5-3-1)12-16-11-8-13-6-9-15-10-7-13/h1-7,16,19,24H,8-15,17-18H2,(H,28,31,32);1-5,13,15H,6-12H2 |
| InChIKey | BISVVXFUPFTCKN-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.89 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|