C75H46N10S — CID 155232338
9-[4-dibenzothiophen-4-yl-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,7-bis(4,6-diphenyl-1,3,5-triazin-2-yl)carbazole (PubChem CID 155232338) has the molecular formula C75H46N10S and a molecular weight of 1119.33 g/mol. Its IUPAC name is 9-[4-dibenzothiophen-4-yl-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,7-bis(4,6-diphenyl-1,3,5-triazin-2-yl)carbazole.
| Compound Name | 9-[4-dibenzothiophen-4-yl-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,7-bis(4,6-diphenyl-1,3,5-triazin-2-yl)carbazole |
|---|---|
| PubChem CID | 155232338 |
| Molecular Formula | C75H46N10S |
| Molecular Weight | 1119.33 g/mol |
| Exact Mass | 1118.36 |
| IUPAC Name | 9-[4-dibenzothiophen-4-yl-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,7-bis(4,6-diphenyl-1,3,5-triazin-2-yl)carbazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc4c5ccc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)cc5n(-c5ccc(-c6cccc7c6sc6ccccc67)cc5-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)c4c3)n2)cc1 |
| InChI | InChI=1S/C75H46N10S/c1-7-22-47(23-8-1)67-76-68(48-24-9-2-10-25-48)80-73(79-67)54-38-41-57-58-42-39-55(74-81-69(49-26-11-3-12-27-49)77-70(82-74)50-28-13-4-14-29-50)46-64(58)85(63(57)45-54)62-43-40-53(56-35-21-36-60-59-34-19-20-37-65(59)86-66(56)60)44-61(62)75-83-71(51-30-15-5-16-31-51)78-72(84-75)52-32-17-6-18-33-52/h1-46H |
| InChIKey | URKBQNFQPYPZKG-UHFFFAOYSA-N |
| XLogP | 18.38 |
| TPSA | 120.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 86 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1119.33 |
| LogP ≤ 5 | 18.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |