C59H34N6S — CID 155628197
2-[9-[4-dibenzothiophen-4-yl-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-7-(2-isocyanophenyl)carbazol-2-yl]benzonitrile (PubChem CID 155628197) has the molecular formula C59H34N6S and a molecular weight of 859.03 g/mol. Its IUPAC name is 2-[9-[4-dibenzothiophen-4-yl-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-7-(2-isocyanophenyl)carbazol-2-yl]benzonitrile.
| Compound Name | 2-[9-[4-dibenzothiophen-4-yl-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-7-(2-isocyanophenyl)carbazol-2-yl]benzonitrile |
|---|---|
| PubChem CID | 155628197 |
| Molecular Formula | C59H34N6S |
| Molecular Weight | 859.03 g/mol |
| Exact Mass | 858.26 |
| IUPAC Name | 2-[9-[4-dibenzothiophen-4-yl-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-7-(2-isocyanophenyl)carbazol-2-yl]benzonitrile |
| SMILES | [C-]#[N+]c1ccccc1-c1ccc2c3ccc(-c4ccccc4C#N)cc3n(-c3ccc(-c4cccc5c4sc4ccccc45)cc3-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c2c1 |
| InChI | InChI=1S/C59H34N6S/c1-61-51-25-12-10-21-44(51)41-28-31-47-46-30-27-40(43-20-9-8-19-42(43)36-60)34-53(46)65(54(47)35-41)52-32-29-39(45-23-14-24-49-48-22-11-13-26-55(48)66-56(45)49)33-50(52)59-63-57(37-15-4-2-5-16-37)62-58(64-59)38-17-6-3-7-18-38/h2-35H |
| InChIKey | IPZKKFZWTYTLDD-UHFFFAOYSA-N |
| XLogP | 15.76 |
| TPSA | 71.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.03 |
| LogP ≤ 5 | 15.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|