C61H44N4O — CID 155233215
9-[4-dibenzofuran-4-yl-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-bis(3,5-dimethylphenyl)carbazole (PubChem CID 155233215) has the molecular formula C61H44N4O and a molecular weight of 849.05 g/mol. Its IUPAC name is 9-[4-dibenzofuran-4-yl-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-bis(3,5-dimethylphenyl)carbazole.
| Compound Name | 9-[4-dibenzofuran-4-yl-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-bis(3,5-dimethylphenyl)carbazole |
|---|---|
| PubChem CID | 155233215 |
| Molecular Formula | C61H44N4O |
| Molecular Weight | 849.05 g/mol |
| Exact Mass | 848.35 |
| IUPAC Name | 9-[4-dibenzofuran-4-yl-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-bis(3,5-dimethylphenyl)carbazole |
| SMILES | Cc1cc(C)cc(-c2ccc3c(c2)c2cc(-c4cc(C)cc(C)c4)ccc2n3-c2ccc(-c3cccc4c3oc3ccccc34)cc2-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C61H44N4O/c1-37-28-38(2)31-46(30-37)43-22-25-54-51(34-43)52-35-44(47-32-39(3)29-40(4)33-47)23-26-55(52)65(54)56-27-24-45(48-19-13-20-50-49-18-11-12-21-57(49)66-58(48)50)36-53(56)61-63-59(41-14-7-5-8-15-41)62-60(64-61)42-16-9-6-10-17-42/h5-36H,1-4H3 |
| InChIKey | CJUJEJXHEYOHTN-UHFFFAOYSA-N |
| XLogP | 16.10 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.05 |
| LogP ≤ 5 | 16.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |