C16H17N5O3S — CID 155235025
1-(3-methylphenyl)sulfonyl-N-[(1-methylpyrazol-4-yl)methyl]pyrazole-3-carboxamide (PubChem CID 155235025) has the molecular formula C16H17N5O3S and a molecular weight of 359.41 g/mol. Its IUPAC name is 1-(3-methylphenyl)sulfonyl-N-[(1-methylpyrazol-4-yl)methyl]pyrazole-3-carboxamide.
| Compound Name | 1-(3-methylphenyl)sulfonyl-N-[(1-methylpyrazol-4-yl)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 155235025 |
| Molecular Formula | C16H17N5O3S |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 1-(3-methylphenyl)sulfonyl-N-[(1-methylpyrazol-4-yl)methyl]pyrazole-3-carboxamide |
| SMILES | Cc1cccc(S(=O)(=O)n2ccc(C(=O)NCc3cnn(C)c3)n2)c1 |
| InChI | InChI=1S/C16H17N5O3S/c1-12-4-3-5-14(8-12)25(23,24)21-7-6-15(19-21)16(22)17-9-13-10-18-20(2)11-13/h3-8,10-11H,9H2,1-2H3,(H,17,22) |
| InChIKey | WBCCRSBXDNUXHP-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 98.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |