C22H24FN3O — CID 155235132
[5-(4-fluorophenyl)-2-(1-methylpiperidin-4-yl)-4-pyridin-4-yl-1H-pyrrol-3-yl]methanol (PubChem CID 155235132) has the molecular formula C22H24FN3O and a molecular weight of 365.45 g/mol. Its IUPAC name is [5-(4-fluorophenyl)-2-(1-methylpiperidin-4-yl)-4-pyridin-4-yl-1H-pyrrol-3-yl]methanol.
| Compound Name | [5-(4-fluorophenyl)-2-(1-methylpiperidin-4-yl)-4-pyridin-4-yl-1H-pyrrol-3-yl]methanol |
|---|---|
| PubChem CID | 155235132 |
| Molecular Formula | C22H24FN3O |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | [5-(4-fluorophenyl)-2-(1-methylpiperidin-4-yl)-4-pyridin-4-yl-1H-pyrrol-3-yl]methanol |
| SMILES | CN1CCC(c2[nH]c(-c3ccc(F)cc3)c(-c3ccncc3)c2CO)CC1 |
| InChI | InChI=1S/C22H24FN3O/c1-26-12-8-17(9-13-26)21-19(14-27)20(15-6-10-24-11-7-15)22(25-21)16-2-4-18(23)5-3-16/h2-7,10-11,17,25,27H,8-9,12-14H2,1H3 |
| InChIKey | GPWXQRDAYYHGBV-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 52.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |