C26H26FN3O — CID 44565093
2-[4-[2-(4-fluorophenyl)-3-pyridin-4-yl-1H-indol-6-yl]piperidin-1-yl]ethanol (PubChem CID 44565093) has the molecular formula C26H26FN3O and a molecular weight of 415.51 g/mol. Its IUPAC name is 2-[4-[2-(4-fluorophenyl)-3-pyridin-4-yl-1H-indol-6-yl]piperidin-1-yl]ethanol.
| Compound Name | 2-[4-[2-(4-fluorophenyl)-3-pyridin-4-yl-1H-indol-6-yl]piperidin-1-yl]ethanol |
|---|---|
| PubChem CID | 44565093 |
| Molecular Formula | C26H26FN3O |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | 2-[4-[2-(4-fluorophenyl)-3-pyridin-4-yl-1H-indol-6-yl]piperidin-1-yl]ethanol |
| SMILES | OCCN1CCC(c2ccc3c(-c4ccncc4)c(-c4ccc(F)cc4)[nH]c3c2)CC1 |
| InChI | InChI=1S/C26H26FN3O/c27-22-4-1-20(2-5-22)26-25(19-7-11-28-12-8-19)23-6-3-21(17-24(23)29-26)18-9-13-30(14-10-18)15-16-31/h1-8,11-12,17-18,29,31H,9-10,13-16H2 |
| InChIKey | XSXZCGAGBCHSBX-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 52.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |